Goniothalamin
Goniothalamin, a natural product isolated and purified from the herbs of Goniothalamus griffithii, enhances rather than inhibits the ATPase activity of a cyanobacterial Hsp90 (HtpG) and a yeast Hsp90, increases both K(m) and k(cat) of the Hsp90s.
| Trivial name | / |
| Catalog Number | CSN14065 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C13H12O2 |
| CAS# | 17303-67-2 |
| Purity | ≥98% |
| SMILES | O=C1C=CC[C@H](/C=C/C2=CC=CC=C2)O1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/goniothalamin.html |