GC376
GC376 is a 3CLpro (3C-like protease) inhibitor that shows promise in treating cats with certain presentations of FIP and has opened the door to targeted antiviral drug therapy.
| Trivial name | GC-376; GC 376 |
| Catalog Number | CSN25342 |
| Alternative Name(s) | GC-376; GC 376 |
| Research Area | Infection |
| Molecular Formula | C21H30N3NaO8S |
| CAS# | 1416992-39-6 |
| Purity | ≥98% |
| SMILES | O=S(C(O)[C@@H](NC([C@@H](NC(OCC1=CC=CC=C1)=O)CC(C)C)=O)CC2C(NCC2)=O)([O-])=O.[Na+] |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/gc376.html |