gamma-Mangostin
gamma-Mangostin, a natural product isolated and purified from the fruits of Garcinia mangostana, has free radical scavenging activity, and antiproliferative and apoptotic activity in HepG2 cells.
| Trivial name | γ-Mangostin |
| Catalog Number | CSN13731 |
| Alternative Name(s) | γ-Mangostin |
| Research Area | Cancer |
| Molecular Formula | C23H24O6 |
| CAS# | 31271-07-5 |
| Purity | ≥98% |
| SMILES | O=C1C2=C(OC3=C1C(CC=C(C)C)=C(O)C(O)=C3)C=C(O)C(CC=C(C)C)=C2O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/gamma-mangostin.html |