Bedaquiline Fumarate
Bedaquiline fumarate, a diarylquinoline antibiotic that targets ATP synthase, is effective for the treatment of Mycobacterium tuberculosis infections.
| Trivial name | R403323; TMC-207 Fumarate; R 207910 Fumarate |
| Catalog Number | CSN13628 |
| Alternative Name(s) | R403323; TMC-207 Fumarate; R 207910 Fumarate |
| Research Area | Infection |
| Molecular Formula | C36H35BrN2O6 |
| CAS# | 845533-86-0 |
| Purity | ≥98% |
| SMILES | O[C@](CCN(C)C)(C1=C2C=CC=CC2=CC=C1)[C@@H](C3=CC4=CC(Br)=CC=C4N=C3OC)C5=CC=CC=C5.O=C(O)/C=C/C(O)=O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/bedaquiline-fumarate.html |