X-Gluc Dicyclohexylamine
X-Gluc is used as a reagent to detect β-glucuronidase, an enzyme produced by the E. Coli bacterium and is widely used in molecular biology experiments to mark and select the expression of target genes (GUS reporter system).
| Trivial name | / |
| Catalog Number | CSN12838 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C26H36BrClN2O7 |
| CAS# | 18656-96-7 |
| Purity | ≥98% |
| SMILES | O=C([C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](OC2=CNC3=C2C(Cl)=C(Br)C=C3)O1)O.C4(NC5CCCCC5)CCCCC4 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/x-gluc-dicyclohexylamine.html |