Punicalagin
Punicalagin, a natural product isolated and purified from the peel of Punica granatum L., is a potential alternative or supplemental agent for prevention of Salmonella infection, has a greater antifungal activity against T.
| Trivial name | / |
| Catalog Number | CSN16007 |
| Alternative Name(s) | / |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C48H28O30 |
| CAS# | 65995-63-3 |
| Purity | ≥98% |
| SMILES | O=C1C2=C(C3=C(O)C(O)=C(O)C=C3C(OC(C(O4)C(OC(C5=CC(O)=C(O)C(O)=C5C6=C(O)C(O)=C(O)C=C6C4=O)=O)C=O)C(COC(C7=CC(O)=C(O)C(O)=C7C8=C9C(O%10)=O)=O)O)=O)C(O)=C(O)C%10=C2C9=C(C(O)=C8O)O1 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/punicalagin.html |