Quercetin 3,4′-Dimethyl Ether
Quercetin 3,4′-dimethyl ether, a natural product isolated and purified from the branch of Tamarix chinensis Lour. With anti-lipid peroxidation (IC50 = 0.3 uM) and anti-inflammatory activities, shows high cytotoxic against leukemia cells.
| Trivial name | / |
| Catalog Number | CSN12401 |
| Alternative Name(s) | / |
| Research Area | Cancer|Immunology/Inflammation |
| Molecular Formula | C17H14O7 |
| CAS# | 33429-83-3 |
| Purity | ≥98% |
| SMILES | O=C1C(OC)=C(C2=CC=C(OC)C(O)=C2)OC3=C1C(O)=CC(O)=C3 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/quercetin-3,4'-dimethyl-ether.html |