5(6)-TAMRA
5(6)-TAMRA contains a carboxylic acid that can be used to react with primary amines via carbodiimide activation of the carboxylic acid. It is a bright, orange-fluorescent dye that produces conjugates with absorption/emission maxima of ~555/580 nm.
| Trivial name | / |
| Catalog Number | CSN10035 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C25H22N2O5 |
| CAS# | 98181-63-6 |
| Purity | ≥98% |
| SMILES | O=C(C1=CC=C(C=C1C2=C3C=CC(N(C)C)=CC3=[O+]C4=C2C=CC(N(C)C)=C4)C(O)=O)[O-].O=C(C5=CC=C(C(C(O)=O)=C5)C6=C7C=CC(N(C)C)=CC7=[O+]C8=C6C=CC(N(C)C)=C8)[O-] |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/5(6)-tamra.html |