NSC 305787 HCl
NSC305787 HCl is a small molecule inhibitor of PKC, with IC50 of 8.3 μM, 9.4 μM, 55 μM for PKCΙ phosphorylation of recombinant ezrin, of moesin, and of radixin.
| Trivial name | / |
| Catalog Number | CSN18323 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C25H31Cl3N2O |
| CAS# | 53868-26-1 |
| Purity | ≥98% |
| SMILES | OC(C1NCCCC1)C2=CC(C3(C4)CC5CC4CC(C5)C3)=NC6=C(Cl)C=C(Cl)C=C26.[H]Cl |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/nsc-305787-hcl.html |