Moexipril HCl
Moexipril HCl is a potent orally active non-sulfhydryl angiotensin converting enzyme (ACE) inhibitor, which is used for the treatment of hypertension and congestive heart failure.
| Trivial name | RS-10085 |
| Catalog Number | CSN11458 |
| Alternative Name(s) | RS-10085 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C27H35ClN2O7 |
| CAS# | 82586-52-5 |
| Purity | ≥98% |
| SMILES | O=C([C@H]1N(C([C@@H](N[C@H](C(OCC)=O)CCC2=CC=CC=C2)C)=O)CC3=C(C=C(OC)C(OC)=C3)C1)O.Cl |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/moexipril-hcl.html |