Alkannin
Alkannin, a natural product isolated and purified from the roots of Lithosperraum erythrorhizon Sieb. et Zucc., can suppress the cell viability, adhesion, invasion and migratory ability of MGC-803 cells through TLR2- or NF-κB-mediated pathway.
| Trivial name | Shikonin |
| Catalog Number | CSN19793 |
| Alternative Name(s) | Shikonin |
| Research Area | Cancer |
| Molecular Formula | C16H16O5 |
| CAS# | 517-88-4 |
| Purity | ≥98% |
| SMILES | O=C1C([C@H](C/C=C(C)/C)O)=CC(C2=C1C(O)=CC=C2O)=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/alkannin.html |