Procyanidin B1
Procyanidin B1, a natrual product isolated and prufied from the fruits of Vitis vinifera L., inhibits infection by vesicular stomatitis virus and HCV pseudotype virus in Huh-7 cells, with IC50 of 29μM and 15μM, respectively.
| Trivial name | Procyanidin-B1 |
| Catalog Number | CSN11778 |
| Alternative Name(s) | Procyanidin-B1 |
| Research Area | Infection |
| Molecular Formula | C30H26O12 |
| CAS# | 20315-25-7 |
| Purity | ≥98% |
| SMILES | O[C@H]1[C@@H](C2=CC=C(O)C(O)=C2)OC3=C(C(O)=CC(O)=C3)[C@@H]1C4=C(O)C=C(O)C5=C4O[C@H](C6=CC=C(O)C(O)=C6)[C@@H](O)C5 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/procyanidin-b1.html |