Fagomine
D-Fagomine is an iminosugar originally isolated from seeds of buckwheat (Fagopyrum sculentum Moench), present in the human diet and now available as a pure crystalline product.
| Trivial name | D-Fagomine |
| Catalog Number | CSN13749 |
| Alternative Name(s) | D-Fagomine |
| Research Area | Metabolic Disease |
| Molecular Formula | C6H13NO3 |
| CAS# | 53185-12-9 |
| Purity | ≥98% |
| SMILES | O[C@@H]1[C@@H](CO)NCC[C@H]1O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/fagomine.html |