Xanthopurpurin
Xanthopurpurin is a natural product isolated and purified from the roots of Rubia cordifolia, effectively inhibits rotavirus multiplication by promoting virus-induced apoptosis in MA-104 cells, and shows mainly strong inhibition of collagen-induced platelet aggregation.
| Trivial name | 1,3-Dihydroxyanthraquinone |
| Catalog Number | CSN17088 |
| Alternative Name(s) | 1,3-Dihydroxyanthraquinone |
| Research Area | / |
| Molecular Formula | C14H8O4 |
| CAS# | 518-83-2 |
| Purity | ≥98% |
| SMILES | O=C1C2=C(C=CC=C2)C(C3=CC(O)=CC(O)=C13)=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/xanthopurpurin.html |