Zatebradine HCl
Zatebradine HCl is a potent HCN channels antagonist, which decreased the heartbeat in a reversible manner with 92% inhibition of the hHCN1-mediated current at 10 μM.
| Trivial name | UL-FS-49 HCl; UL FS 49CL |
| Catalog Number | CSN18579 |
| Alternative Name(s) | UL-FS-49 HCl; UL FS 49CL |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C26H37ClN2O5 |
| CAS# | 91940-87-3 |
| Purity | ≥98% |
| SMILES | O=C1N(CCCN(CCC2=CC=C(OC)C(OC)=C2)C)CCC3=CC(OC)=C(OC)C=C3C1.Cl |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/zatebradine-hcl.html |