Y-33075
Y-33075 is potent and selective p160 ROCK inhibitor with an Ki value of 0.14 μM, > 200 fold selectivity for p160ROCK than PKC, cAMP-dependent protein kianse and Mypsin light-chain kinase.
| Trivial name | Y 39983 |
| Catalog Number | CSN18082 |
| Alternative Name(s) | Y 39983 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C16H16N4O |
| CAS# | 199433-58-4 |
| Purity | ≥98% |
| SMILES | O=C(NC1=C2C(NC=C2)=NC=C1)C3=CC=C(C=C3)[C@H](N)C |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/y-33075.html |