furaprofen
Furaprofen is an inhibitor of HCV replication and it is substantially more potent against genotype 1a and 1b replicons (EC50 ≈ 30 nM) than genotype 2a (EC50 ≈ 1 μM).
| Trivial name | R803 |
| Catalog Number | CSN21653 |
| Alternative Name(s) | R803 |
| Research Area | / |
| Molecular Formula | C17H14O3 |
| CAS# | 67700-30-5 |
| Purity | ≥98% |
| SMILES | O=C(O)C(C)C1=C(OC=C2C3=CC=CC=C3)C2=CC=C1 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/furaprofen.html |