α-Cyperone
α-Cyperone, a natural product isolated and purified from the hizomes of Cyperus rotundus L., is associated with the down-regulation of COX-2,IL-6,Nck-2,Cdc42 and Rac1, resulting in reduction of inflammation.
| Trivial name | Eudesma-4,11-Dien-3-One |
| Catalog Number | CSN17004 |
| Alternative Name(s) | Eudesma-4,11-Dien-3-One |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C15H22O |
| CAS# | 473-08-5 |
| Purity | ≥98% |
| SMILES | CC(C(CC[C@@](C)1CC2)=O)=C1C[C@@H]2C(C)=C |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/a-cyperone.html |