Licoisoflavone A
Licoisoflavone A is a potential MRP inhibitor isolated and purified from the roots of Glycyrrhiza uralensis Fisch, shows inhibitory effects on copper-induced protein oxidative modification of mice brain homogenate in vitro.
| Trivial name | / |
| Catalog Number | CSN14317 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C20H18O6 |
| CAS# | 66056-19-7 |
| Purity | ≥98% |
| SMILES | O=C1C(C2=CC=C(O)C(C/C=C(C)\C)=C2O)=COC3=CC(O)=CC(O)=C13 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/licoisoflavone-a.html |