Oroxin A
Oroxin A is the major component of an ethanol-water Oroxylum indicum (L.) Kurz (Bignoniaceae) seed extract (OISE), activates peroxisome proliferator-activated receptor γ (PPARγ) by docking into the PPARγ protein ligand-binding domain. Oroxin A exhibits an inhibitory activity against α-glucosidase and an antioxidant capacity[1]. Oroxin A exerts anti-breast cancer effects by inducing ER stress-mediated senescence[2].
| Trivial name | / |
| Catalog Number | CSN25412 |
| Alternative Name(s) | / |
| Research Area | Immunology/Inflammation|Cancer |
| Molecular Formula | C21H20O10 |
| CAS# | 57396-78-8 |
| Purity | ≥98% |
| SMILES | O=C1C=C(C2=CC=CC=C2)OC3=C1C(O)=C(O)C(O[C@H]4[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O4)=C3 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/oroxin-a.html |