Pterosin B
Pterosin B is a natural product isolated and purified from the aerial parts of Pteris semipinnata, is a salt-inducible kinase 3 (Sik3) pathway inhibitor, preventing chondrocyte hypertrophy and osteoarthritis in mice by inhibiting Sik3.
| Trivial name | Pterosin-B |
| Catalog Number | CSN14948 |
| Alternative Name(s) | Pterosin-B |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C14H18O2 |
| CAS# | 34175-96-7 |
| Purity | ≥98% |
| SMILES | O=C1[C@H](C)CC2=C1C(C)=C(CCO)C(C)=C2 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/pterosin-b.html |