Methiothepin Mesylate
Methiothepin mesylate is a potent and non-selective 5-HT2 receptor antagonist, with pKds of 7.10 (5-HT1A), 7.28 (5HT1B), 7.56 (5HT1C), 6.99 (5HT1D), 7.0 (5-HT5A), 7.8 (5-HT5B), 8.74 (5-HT6), and 8.99 (5-HT7), and pKis of 8.50 (5HT2A), 8.68 (5HT2B), and 8.35 (5HT2C).
| Trivial name | Metitepine mesylate; Ro 8-6837 mesylate |
| Catalog Number | CSN21278 |
| Alternative Name(s) | Metitepine mesylate; Ro 8-6837 mesylate |
| Research Area | Neurological Disease |
| Molecular Formula | C21H28N2O3S3 |
| CAS# | 74611-28-2 |
| Purity | ≥98% |
| SMILES | CN1CCN(C2CC3=CC=CC=C3SC4=CC=C(SC)C=C24)CC1.CS(=O)(O)=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/methiothepin-mesylate.html |