Calcium Levofolinate
Calcium levofolinate is the calcium salt of levoleucovorin, which is the enantiomerically active form of folinic acid.
| Trivial name | Calcium Folinate; CL307782; Folinic Acid Calcium Salt |
| Catalog Number | CSN10527 |
| Alternative Name(s) | Calcium Folinate; CL307782; Folinic Acid Calcium Salt |
| Research Area | Cancer |
| Molecular Formula | C20H21CaN7O7 |
| CAS# | 80433-71-2 |
| Purity | ≥98% |
| SMILES | O=CN1C(CNC(N=C(N2)N)=C1C2=O)CNC3=CC=C(C=C3)C(NC(CCC([O-])=O)C([O-])=O)=O.[Ca+2] |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/calcium-levofolinate.html |