Alpinumisoflavone
Alpinumisoflavone, a natural product isolated and purified from the herbs of Genista pichisermolliana with athereprotective and estrogenic properties, induces cell death via repressing both the ERK/MAPK and NF-κB pathways.
| Trivial name | / |
| Catalog Number | CSN14260 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C20H16O5 |
| CAS# | 34086-50-5 |
| Purity | ≥98% |
| SMILES | O=C1C(C(O)=C(C=CC(C)(C)O2)C2=C3)=C3OC=C1C4=CC=C(O)C=C4 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/alpinumisoflavone.html |