Misoprostol
Misoprostol is a synthetic prostaglandin E1 (PGE1) analog that is used to prevent gastric ulcers, to treat missed miscarriage, to induce labor, and to induce abortion.
| Trivial name | SC-29333 |
| Catalog Number | CSN16851 |
| Alternative Name(s) | SC-29333 |
| Research Area | Endocrinology |
| Molecular Formula | C22H38O5 |
| CAS# | 59122-46-2 |
| Purity | ≥98% |
| SMILES | O[C@H](C1)[C@@H]([C@H](C1=O)CCCCCCC(OC)=O)/C=C/CC(C)(O)CCCC |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/misoprostol.html |