Emricasan
Emricasan, also called IDN-6556 or PF-03491390, is an inhibitor of activated caspases, and it has sub- to nanomolar activity in vitro.
| Trivial name | IDN-6556; PF 03491390 |
| Catalog Number | CSN12697 |
| Alternative Name(s) | IDN-6556; PF 03491390 |
| Research Area | Cancer |
| Molecular Formula | C26H27F4N3O7 |
| CAS# | 254750-02-2 |
| Purity | ≥98% |
| SMILES | O=C(O)C[C@H](NC([C@@H](NC(C(NC1=CC=CC=C1C(C)(C)C)=O)=O)C)=O)C(COC2=C(F)C(F)=CC(F)=C2F)=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/emricasan.html |