Amsacrine HCl
Amsacrine HCl is an antineoplastic agent which can intercalate into the DNA of tumor cells.
Trivial name | AMSA HCl; M-AMSA HCl; CI-880 HCl; SN-11841 HCl |
Catalog Number | CSN10306 |
Alternative Name(s) | AMSA HCl; M-AMSA HCl; CI-880 HCl; SN-11841 HCl |
Research Area | Cancer |
Molecular Formula | C21H20ClN3O3S |
CAS# | 54301-15-4 |
Purity | ≥98% |
SMILES | CS(=O)(NC1=CC=C(NC2=C(C=CC=C3)C3=NC4=CC=CC=C42)C(OC)=C1)=O.[H]Cl |
Size | 10mg |
Supplier Page | https://www.csnpharm.com/products/amsacrine-hcl.html |