Pimaric Acid
Pimaric acid is a natural product isolated and purified from the herbs of Aralia cordata having a potent anti-atherosclerotic activity with inhibitory action on matrix metalloproteinase-9 production and cell migration in TNF-α-induced human aortic smooth muscle cells.
| Trivial name | / |
| Catalog Number | CSN11720 |
| Alternative Name(s) | / |
| Research Area | Infection|Immunology/Inflammation |
| Molecular Formula | C20H30O2 |
| CAS# | 127-27-5 |
| Purity | ≥98% |
| SMILES | O=C([C@]1(C)CCC[C@]2(C)[C@@]3([H])CC[C@](C=C)(C)C=C3CC[C@@]12[H])O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/pimaric-acid.html |