Etebenecid
Etebenecid is a uricosuric agents, lower uric acid levels in the body by increasing the elimination of uric acid by the kidneys, also inhibits penicillin tubular secretion.
| Trivial name | 4-Diethylsulfamoyl-Benzoic Acid |
| Catalog Number | CSN11497 |
| Alternative Name(s) | 4-Diethylsulfamoyl-Benzoic Acid |
| Research Area | Metabolic Disease |
| Molecular Formula | C11H15NO4S |
| CAS# | 1213-06-5 |
| Purity | ≥98% |
| SMILES | O=C(O)C1=CC=C(S(=O)(N(CC)CC)=O)C=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/etebenecid.html |