beta-Tocotrienol
beta-Tocotrienol, a natural product isolated and purified from the stem bark of Garcinia virgata, is to serve as an anticancer agent for treating human lung and brain cancers. beta-Tocotrienol inhibits the growth of both A549 (GI50=1.38±0.334μM) and U87MG (GI50=2.53±0.604μM) cells at rather low concentrations.
| Trivial name | β-Tocotrienol |
| Catalog Number | CSN13826 |
| Alternative Name(s) | β-Tocotrienol |
| Research Area | Cancer |
| Molecular Formula | C28H42O2 |
| CAS# | 490-23-3 |
| Purity | ≥98% |
| SMILES | OC1=CC(C)=C2C(CC[C@](CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/C)(C)O2)=C1C |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/beta-tocotrienol.html |