Boc-Val-Cit-PABA
Linker for Antibody-Drug-Conjugation (ADC). The Val-Cit will specifically be cleaved by catepsin B. As this enzyme is only present in the lysosome the ADC payload will be release only in the cell.
| Trivial name | / |
| Catalog Number | CSN21211 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C23H37N5O6 |
| CAS# | 870487-09-5 |
| Purity | ≥98% |
| SMILES | O=C(NCCC[C@H](NC([C@@H](NC(OC(C)(C)C)=O)C(C)C)=O)C(NC1=CC=C(CO)C=C1)=O)N |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/boc-val-cit-paba.html |