Caerulomycin A
Caerulomycin A is a rare and unusual antibiotic containing a core 2, 2′-bispyridyl with an oxime substituent, isolated and purified from a strain of Streptomyces caeruleus.
| Trivial name | Cerulomycin |
| Catalog Number | CSN20423 |
| Alternative Name(s) | Cerulomycin |
| Research Area | / |
| Molecular Formula | C12H11N3O2 |
| CAS# | 21802-37-9 |
| Purity | ≥98% |
| SMILES | COC1=CC(C2=NC=CC=C2)=NC(/C=N/O)=C1 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/caerulomycin-a.html |