XE991 2HCl
XE991 2HCl is a potent and selective blocker of KV7 (KCNQ) voltage-gated potassium channels which blocks KV7.2+7.3 (KCNQ2+3) / M-currents (IC50 = 0.6 – 0.98 μM) and KV7.1 (KCNQ1) homomeric channels (IC50 = 0.75 μM) but is less potent against KV7.1/minK channels (IC50 = 11.1 μM).
| Trivial name | LS190926 2HCl |
| Catalog Number | CSN20025 |
| Alternative Name(s) | LS190926 2HCl |
| Research Area | Neurological Disease |
| Molecular Formula | C26H22Cl2N2O |
| CAS# | 122955-13-9 |
| Purity | ≥98% |
| SMILES | O=C1C2=C(C=CC=C2)C(CC3=CC=NC=C3)(CC4=CC=NC=C4)C5=CC=CC=C15.[H]Cl.[H]Cl |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/xe991-2hcl.html |