Bilobetin
Bilobetin, a natural product isolated and purified from the leaves of Ginkgo biloba L., whose treatment ameliorates hyperlipidaemia, lipotoxicity and insulin resistance in rats by stimulating PPARα-mediated lipid catabolism.
| Trivial name | / |
| Catalog Number | CSN10449 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C31H20O10 |
| CAS# | 521-32-4 |
| Purity | ≥98% |
| SMILES | O=C1C=C(C2=CC=C(O)C=C2)OC3=C(C4=CC(C5=CC(C6=C(O)C=C(O)C=C6O5)=O)=CC=C4OC)C(O)=CC(O)=C13 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/bilobetin.html |