Norcepharadione B
Norcepharadione B, a natural product isolated and purified from the herbs of Houttuynia cordata Thunb. with good inhibitory activity against the replication of HSV-1, exhibits significant cytotoxicity against five human tumor cell lines (A-549, SK-OV-3, SK-MEL-2, XF-498 and HCT-15) in vitro.
| Trivial name | Norcepharadione-B |
| Catalog Number | CSN15263 |
| Alternative Name(s) | Norcepharadione-B |
| Research Area | / |
| Molecular Formula | C18H13NO4 |
| CAS# | 57576-41-7 |
| Purity | ≥98% |
| SMILES | O=C1C(NC2=C3C1=CC(OC)=C(OC)C3=C4C(C=CC=C4)=C2)=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/norcepharadione-b.html |