Asparagine monohydrate
L-asparagine is a non-essential amino acid that is involved in the metabolic control of cell functions in nerve and brain tissue, being used for a variety of pharmaceutical applications.
| Trivial name | / |
| Catalog Number | CSN24091 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C4H10N2O4 |
| CAS# | 5794-13-8 |
| Purity | ≥98% |
| SMILES | O=C(O)[C@@H](N)CC(N)=O.[H]O[H] |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/asparagine-monohydrate.html |