Euxanthone
Euxanthone, a natural product isolated and purified from the roots of Polygala tenuifolia Willd., induces neurite outgrowth which actively regulated by transcription factor E2F-5 via PKC pathway.
| Trivial name | 1,7-Dihydroxy-9H-Xanthen-9-One |
| Catalog Number | CSN19344 |
| Alternative Name(s) | 1,7-Dihydroxy-9H-Xanthen-9-One |
| Research Area | / |
| Molecular Formula | C13H8O4 |
| CAS# | 529-61-3 |
| Purity | ≥98% |
| SMILES | O=C1C2=C(OC3=C1C=C(O)C=C3)C=CC=C2O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/euxanthone.html |