Bifluranol
Bifluranol is a synthetic nonsteroidal estrogen of the stilbestrol group related to diethylstilbestrol that has been used as an antiandrogen in the United Kingdom in the treatment of benign prostatic hyperplasia.
| Trivial name | Prostarex |
| Catalog Number | CSN21522 |
| Alternative Name(s) | Prostarex |
| Research Area | / |
| Molecular Formula | C17H18F2O2 |
| CAS# | 34633-34-6 |
| Purity | ≥98% |
| SMILES | C[C@H](C1=CC=C(O)C(F)=C1)[C@H](C2=CC=C(O)C(F)=C2)CC |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/bifluranol.html |