5-Fluorocytidine
5-Fluorocytidine could replace cytidine and be incorporated into cellular RNAs or tRNAs.The bacterial enzyme cytosine deaminase has been used as a negative selection marker system. Cells that express cytosine deaminase convert 5-fluorocytosine to the toxic compound 5-fluorouracil, and transformed seedlings can thus be identified using medium containing 5-fluorocytosine.
| Trivial name | 5-FC;Flucytosine |
| Catalog Number | CSN25530 |
| Alternative Name(s) | 5-FC;Flucytosine |
| Research Area | Infection |
| Molecular Formula | C9H12FN3O5 |
| CAS# | 2341-22-2 |
| Purity | ≥98% |
| SMILES | O=C1N=C(N)C(F)=CN1[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/4-amino-1-((2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-fluoropyrimidin-2(1h)-one.html |