Tranylcypromine HCl
Tranylcypromine HCl, is a monoamine oxidase inhibitor (MAOI) that irreversibly inhibits MAO A and MAO B with the inhibition constant Ki values of 101.9 μM and 16 μM and the half maximal inhibition concentration IC50 values of 2.3 μM and 0.95 μM respectively.
| Trivial name | / |
| Catalog Number | CSN15979 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C9H12ClN |
| CAS# | 4548-34-9 |
| Purity | ≥98% |
| SMILES | N[C@@H]1[C@@H](C2=CC=CC=C2)C1.[H]Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/tranylcypromine-hcl.html |