Batimastat
Batimastat is a potent broad spectrum MMP inhibitor with IC50 of 3, 4, 4, 6, and 20 nM for MMP-1, MMP-2, MMP-9, MMP-7 and MMP-3, respectively.
| Trivial name | BB-94 |
| Catalog Number | CSN17343 |
| Alternative Name(s) | BB-94 |
| Research Area | Cancer |
| Molecular Formula | C23H31N3O4S2 |
| CAS# | 130370-60-4 |
| Purity | ≥98% |
| SMILES | O=C(NO)[C@@H](CSC1=CC=CS1)[C@@H](CC(C)C)C(N[C@@H](CC2=CC=CC=C2)C(NC)=O)=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/batimastat.html |