Pterosin Z
Pterosin Z, a natural product isolated and purified from the rhizoma of Cibotium barometz (L.) J.Sm. with smooth muscle relaxant activity, is approximately equipotent with that of the related fungal pterosin (EC50 of 2.9 +/- 1.6 x 10(-6) M).
| Trivial name | Pterosin-Z |
| Catalog Number | CSN14936 |
| Alternative Name(s) | Pterosin-Z |
| Research Area | / |
| Molecular Formula | C15H20O2 |
| CAS# | 34169-69-2 |
| Purity | ≥98% |
| SMILES | O=C1C(C)(C)CC2=C1C(C)=C(CCO)C(C)=C2 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/pterosin-z.html |