Fiacitabine
Fiacitabine is a selective inhibitior of DNA replication of herpes simplex virus (HSV) with IC50 values of 2.5 nM and 12.6 nM for HSV1 and HSV2, respectively.
| Trivial name | NSC 382097; FIAC; FOAC |
| Catalog Number | CSN11011 |
| Alternative Name(s) | NSC 382097; FIAC; FOAC |
| Research Area | Infection |
| Molecular Formula | C9H11FIN3O4 |
| CAS# | 69123-90-6 |
| Purity | ≥98% |
| SMILES | O=C1N=C(N)C(I)=CN1[C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2F |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/fiacitabine.html |