1,8-Dihydroxyanthraquinone
1,8-Dihydroxyanthraquinone is a synthetic anthraquinone derivative, currently used as an antioxidant in synthetic lubricants, in the synthesis of antitumor agents, as a fungicide and as an intermediate for making dyes. It is also an inhibitor of 6-phosphogluconate dehydrogenase (6PGD).
| Trivial name | Chrysazin; Antrapurol; Dantron |
| Catalog Number | CSN17102 |
| Alternative Name(s) | Chrysazin; Antrapurol; Dantron |
| Research Area | / |
| Molecular Formula | C14H8O4 |
| CAS# | 117-10-2 |
| Purity | ≥98% |
| SMILES | O=C(C1=C2C(O)=CC=C1)C3=CC=CC(O)=C3C2=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/1,8-dihydroxyanthraquinone.html |