Neochamaejasmine B
Neochamaejasmine B, a natural product isolated and purified from the roots of Stellera chamaejasme Linn. with antibacterial activity on Gram-positive bacterium and Gram-negative bacterium, displays nematicidal activity against both Bursaphelenchus xylophilus and Bursaphelenchus mucronatus, and reduces seedling growth and disrupt root development, the IC50 value of 6.9 ug/mL.
| Trivial name | Neochamaejasmin B |
| Catalog Number | CSN15108 |
| Alternative Name(s) | Neochamaejasmin B |
| Research Area | / |
| Molecular Formula | C30H22O10 |
| CAS# | 90411-12-4 |
| Purity | ≥98% |
| SMILES | O=C1[C@H]([C@@H]2[C@@H](C3=CC=C(O)C=C3)OC4=CC(O)=CC(O)=C4C2=O)[C@H](C5=CC=C(O)C=C5)OC6=CC(O)=CC(O)=C16 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/neochamaejasmine-b.html |