6-Hydroxyflavone
6-Hydroxyflavone is a naturally occurring flavone, with anti-inflammatory activity. 6-Hydroxyflavone exhibits inhibitory effect towards bovine hemoglobin (BHb) glycation. 6-Hydroxyflavone can activate AKT, ERK 1/2, and JNK signaling pathways to effectively promote osteoblastic differentiation. 6-Hydroxyflavone inhibits the LPS-induced NO production[1] [2].
Trivial name | 6-HF |
Catalog Number | CSN23331 |
Alternative Name(s) | 6-HF |
Research Area | Immunology/Inflammation |
Molecular Formula | C15H10O3 |
CAS# | 6665-83-4 |
Purity | ≥98% |
SMILES | O=C1C=C(C2=CC=CC=C2)OC3=C1C=C(O)C=C3 |
Size | 25mg |
Supplier Page | https://www.csnpharm.com/products/6-hydroxyflavone.html |