Tandospirone
Tandospirone is a potent and selective 5-HT1A receptor partial agonist (Ki = 27 nM) that displays selectivity over SR-2, SR-1C, α1-adrenergic, α2-adrenergic, D1 and D2 receptors (Ki values ranging from 1300-41000 nM).
| Trivial name | SM-3997 |
| Catalog Number | CSN12032 |
| Alternative Name(s) | SM-3997 |
| Research Area | Neurological Disease |
| Molecular Formula | C21H29N5O2 |
| CAS# | 87760-53-0 |
| Purity | ≥98% |
| SMILES | O=C1[C@]2([H])[C@]([C@H]3CC[C@@H]2C3)([H])C(N1CCCCN(CC4)CCN4C5=NC=CC=N5)=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/tandospirone.html |