Albiflorin
Albiflorin is a natural product isolated and purified from the roots of Paeonia albiflora. It is also a major constituent contained in peony root which possesses therapeutic potential for neurodegenerative diseases.
| Trivial name | / |
| Catalog Number | CSN10185 |
| Alternative Name(s) | / |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C23H28O11 |
| CAS# | 39011-90-0 |
| Purity | ≥98% |
| SMILES | O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1O)OC23C4(C(OC2(CC(C4C3)O)C)=O)COC(C5=CC=CC=C5)=O)CO)O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/albiflorin.html |