Brevilin A
Brevilin A, a natural product isolated and purified from the herbs of Centipeda minima, is a strong impetus for the development of selective JAK-STAT inhibitors and therapeutic drugs in order to improve survival of patients with hyperactivated JAKs and STATs, and has antigiardial activity (IC50 = 16.1 μM) and was similarly active in vitro against Entamoeba histolytica (IC50 between 4.5 and 9 μM) and against Plasmodium falciparum (IC50 = 9.42 μM).
| Trivial name | Brevilin-A |
| Catalog Number | CSN14698 |
| Alternative Name(s) | Brevilin-A |
| Research Area | / |
| Molecular Formula | C20H26O5 |
| CAS# | 16503-32-5 |
| Purity | ≥98% |
| SMILES | C/C=C(C)\C(O[C@@H]([C@@]([C@@H]1C)([H])[C@]2([H])OC1=O)[C@]3(C)C(C=C[C@@]3([H])[C@H](C)C2)=O)=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/brevilin-a.html |