FITC
FITC is a derivative of fluorescein used in wide-ranging applications including flow cytometry. FITC has excitation and emission spectrum peak wavelengths of approximately 495 nm/519 nm.
| Trivial name | Fluorescein 5-Isothiocyanate |
| Catalog Number | CSN10957 |
| Alternative Name(s) | Fluorescein 5-Isothiocyanate |
| Research Area | / |
| Molecular Formula | C21H11NO5S |
| CAS# | 3326-32-7 |
| Purity | ≥98% |
| SMILES | O=C1OC2(C3=C(OC4=C2C=CC(O)=C4)C=C(O)C=C3)C5=C1C=C(N=C=S)C=C5 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/fitc.html |